C16H29NO5 — CID 10380999
tert-butyl (2S,3R)-2-butyl-3-(1-ethoxyethoxy)-4-oxoazetidine-1-carboxylate (PubChem CID 10380999) has the molecular formula C16H29NO5 and a molecular weight of 315.41 g/mol. Its IUPAC name is tert-butyl (2S,3R)-2-butyl-3-(1-ethoxyethoxy)-4-oxoazetidine-1-carboxylate.
| Compound Name | tert-butyl (2S,3R)-2-butyl-3-(1-ethoxyethoxy)-4-oxoazetidine-1-carboxylate |
|---|---|
| PubChem CID | 10380999 |
| Molecular Formula | C16H29NO5 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.20 |
| IUPAC Name | tert-butyl (2S,3R)-2-butyl-3-(1-ethoxyethoxy)-4-oxoazetidine-1-carboxylate |
| SMILES | CCCC[C@H]1[C@@H](OC(C)OCC)C(=O)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H29NO5/c1-7-9-10-12-13(21-11(3)20-8-2)14(18)17(12)15(19)22-16(4,5)6/h11-13H,7-10H2,1-6H3/t11?,12-,13+/m0/s1 |
| InChIKey | NPJWPMRSGXLEQA-LWNNLKQOSA-N |
| XLogP | 3.09 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|