C25H21NO4 — CID 101110669
[(2R,3R)-1-benzoyl-3-benzyl-4-oxoazetidin-2-yl]methyl benzoate (PubChem CID 101110669) has the molecular formula C25H21NO4 and a molecular weight of 399.45 g/mol. Its IUPAC name is [(2R,3R)-1-benzoyl-3-benzyl-4-oxoazetidin-2-yl]methyl benzoate.
| Compound Name | [(2R,3R)-1-benzoyl-3-benzyl-4-oxoazetidin-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 101110669 |
| Molecular Formula | C25H21NO4 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | [(2R,3R)-1-benzoyl-3-benzyl-4-oxoazetidin-2-yl]methyl benzoate |
| SMILES | O=C(OC[C@H]1[C@@H](Cc2ccccc2)C(=O)N1C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H21NO4/c27-23(19-12-6-2-7-13-19)26-22(17-30-25(29)20-14-8-3-9-15-20)21(24(26)28)16-18-10-4-1-5-11-18/h1-15,21-22H,16-17H2/t21-,22+/m1/s1 |
| InChIKey | SEONJCXZDKKLRX-YADHBBJMSA-N |
| XLogP | 3.75 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|