C35H41N4O5Si — CID 67883485
CID 67883485 (PubChem CID 67883485) has the molecular formula C35H41N4O5Si and a molecular weight of 625.82 g/mol.
| Compound Name | CID 67883485 |
|---|---|
| PubChem CID | 67883485 |
| Molecular Formula | C35H41N4O5Si |
| Molecular Weight | 625.82 g/mol |
| Exact Mass | 625.28 |
| IUPAC Name | — |
| SMILES | C[Si](C)[C@@]1(CCCN=C(NC(=O)Oc2ccccc2)NC(=O)Oc2ccccc2)C(=O)N(C(C)(C)C)[C@@H]1/C=C/c1ccccc1 |
| InChI | InChI=1S/C35H41N4O5Si/c1-34(2,3)39-29(23-22-26-16-9-6-10-17-26)35(30(39)40,45(4)5)24-15-25-36-31(37-32(41)43-27-18-11-7-12-19-27)38-33(42)44-28-20-13-8-14-21-28/h6-14,16-23,29H,15,24-25H2,1-5H3,(H2,36,37,38,41,42)/b23-22+/t29-,35-/m1/s1 |
| InChIKey | OUPPHRGENNBJSZ-FXXLAVNKSA-N |
| XLogP | 6.92 |
| TPSA | 109.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.82 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|