C11H21NO3Si — CID 10037438
(2R,3R)-1-[tert-butyl(dimethyl)silyl]-3-methyl-4-oxoazetidine-2-carboxylic acid (PubChem CID 10037438) has the molecular formula C11H21NO3Si and a molecular weight of 243.38 g/mol. Its IUPAC name is (2R,3R)-1-[tert-butyl(dimethyl)silyl]-3-methyl-4-oxoazetidine-2-carboxylic acid.
| Compound Name | (2R,3R)-1-[tert-butyl(dimethyl)silyl]-3-methyl-4-oxoazetidine-2-carboxylic acid |
|---|---|
| PubChem CID | 10037438 |
| Molecular Formula | C11H21NO3Si |
| Molecular Weight | 243.38 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | (2R,3R)-1-[tert-butyl(dimethyl)silyl]-3-methyl-4-oxoazetidine-2-carboxylic acid |
| SMILES | C[C@H]1C(=O)N([Si](C)(C)C(C)(C)C)[C@H]1C(=O)O |
| InChI | InChI=1S/C11H21NO3Si/c1-7-8(10(14)15)12(9(7)13)16(5,6)11(2,3)4/h7-8H,1-6H3,(H,14,15)/t7-,8-/m1/s1 |
| InChIKey | JOUXPQKPKJSQDD-HTQZYQBOSA-N |
| XLogP | 1.92 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.38 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|