C33H47N3O7Si — CID 70878650
benzyl (2S)-3-[[2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-pyridinyl]methyl]-1-[tert-butyl(dimethyl)silyl]-4-oxoazetidine-2-carboxylate (PubChem CID 70878650) has the molecular formula C33H47N3O7Si and a molecular weight of 625.84 g/mol. Its IUPAC name is benzyl (2S)-3-[[2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-pyridinyl]methyl]-1-[tert-butyl(dimethyl)silyl]-4-oxoazetidine-2-carboxylate.
| Compound Name | benzyl (2S)-3-[[2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-pyridinyl]methyl]-1-[tert-butyl(dimethyl)silyl]-4-oxoazetidine-2-carboxylate |
|---|---|
| PubChem CID | 70878650 |
| Molecular Formula | C33H47N3O7Si |
| Molecular Weight | 625.84 g/mol |
| Exact Mass | 625.32 |
| IUPAC Name | benzyl (2S)-3-[[2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-pyridinyl]methyl]-1-[tert-butyl(dimethyl)silyl]-4-oxoazetidine-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N(C(=O)OC(C)(C)C)c1cc(CC2C(=O)N([Si](C)(C)C(C)(C)C)[C@@H]2C(=O)OCc2ccccc2)ccn1 |
| InChI | InChI=1S/C33H47N3O7Si/c1-31(2,3)42-29(39)35(30(40)43-32(4,5)6)25-20-23(17-18-34-25)19-24-26(28(38)41-21-22-15-13-12-14-16-22)36(27(24)37)44(10,11)33(7,8)9/h12-18,20,24,26H,19,21H2,1-11H3/t24?,26-/m0/s1 |
| InChIKey | SMRZVUOBVYXKRK-JKGBFCRXSA-N |
| XLogP | 6.88 |
| TPSA | 115.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.84 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|