C7H12N2O2S — CID 79775147
5-(2-methoxyethoxymethyl)-1,3-thiazol-2-amine (PubChem CID 79775147) has the molecular formula C7H12N2O2S and a molecular weight of 188.25 g/mol. Its IUPAC name is 5-(2-methoxyethoxymethyl)-1,3-thiazol-2-amine.
| Compound Name | 5-(2-methoxyethoxymethyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 79775147 |
| Molecular Formula | C7H12N2O2S |
| Molecular Weight | 188.25 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | 5-(2-methoxyethoxymethyl)-1,3-thiazol-2-amine |
| SMILES | COCCOCc1cnc(N)s1 |
| InChI | InChI=1S/C7H12N2O2S/c1-10-2-3-11-5-6-4-9-7(8)12-6/h4H,2-3,5H2,1H3,(H2,8,9) |
| InChIKey | OMPURIDQMANAFD-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.25 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|