C7H12N2O3S — CID 126619372
2-(2-amino-1,3-thiazol-5-yl)acetic acid;methoxymethane (PubChem CID 126619372) has the molecular formula C7H12N2O3S and a molecular weight of 204.25 g/mol. Its IUPAC name is 2-(2-amino-1,3-thiazol-5-yl)acetic acid;methoxymethane.
| Compound Name | 2-(2-amino-1,3-thiazol-5-yl)acetic acid;methoxymethane |
|---|---|
| PubChem CID | 126619372 |
| Molecular Formula | C7H12N2O3S |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | 2-(2-amino-1,3-thiazol-5-yl)acetic acid;methoxymethane |
| SMILES | COC.Nc1ncc(CC(=O)O)s1 |
| InChI | InChI=1S/C5H6N2O2S.C2H6O/c6-5-7-2-3(10-5)1-4(8)9;1-3-2/h2H,1H2,(H2,6,7)(H,8,9);1-2H3 |
| InChIKey | QTHOKBCNSUZCPB-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 85.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |