C13H13NO4S — CID 82369371
2-[2-(3,5-dimethoxyphenyl)-1,3-thiazol-5-yl]acetic acid (PubChem CID 82369371) has the molecular formula C13H13NO4S and a molecular weight of 279.32 g/mol. Its IUPAC name is 2-[2-(3,5-dimethoxyphenyl)-1,3-thiazol-5-yl]acetic acid.
| Compound Name | 2-[2-(3,5-dimethoxyphenyl)-1,3-thiazol-5-yl]acetic acid |
|---|---|
| PubChem CID | 82369371 |
| Molecular Formula | C13H13NO4S |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | 2-[2-(3,5-dimethoxyphenyl)-1,3-thiazol-5-yl]acetic acid |
| SMILES | COc1cc(OC)cc(-c2ncc(CC(=O)O)s2)c1 |
| InChI | InChI=1S/C13H13NO4S/c1-17-9-3-8(4-10(5-9)18-2)13-14-7-11(19-13)6-12(15)16/h3-5,7H,6H2,1-2H3,(H,15,16) |
| InChIKey | OTUVCKYRQLNVDI-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |