C11H11Cl2NOS — CID 54759132
5-(chloromethyl)-2-(3-methoxyphenyl)-1,3-thiazole;hydrochloride (PubChem CID 54759132) has the molecular formula C11H11Cl2NOS and a molecular weight of 276.19 g/mol. Its IUPAC name is 5-(chloromethyl)-2-(3-methoxyphenyl)-1,3-thiazole;hydrochloride.
| Compound Name | 5-(chloromethyl)-2-(3-methoxyphenyl)-1,3-thiazole;hydrochloride |
|---|---|
| PubChem CID | 54759132 |
| Molecular Formula | C11H11Cl2NOS |
| Molecular Weight | 276.19 g/mol |
| Exact Mass | 274.99 |
| IUPAC Name | 5-(chloromethyl)-2-(3-methoxyphenyl)-1,3-thiazole;hydrochloride |
| SMILES | COc1cccc(-c2ncc(CCl)s2)c1.Cl |
| InChI | InChI=1S/C11H10ClNOS.ClH/c1-14-9-4-2-3-8(5-9)11-13-7-10(6-12)15-11;/h2-5,7H,6H2,1H3;1H |
| InChIKey | XRRDBPFWNHZRFY-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.19 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|