C11H10N2O3S — CID 140557880
2-[4-[(2-amino-1,3-thiazol-5-yl)oxy]phenyl]acetic acid (PubChem CID 140557880) has the molecular formula C11H10N2O3S and a molecular weight of 250.28 g/mol. Its IUPAC name is 2-[4-[(2-amino-1,3-thiazol-5-yl)oxy]phenyl]acetic acid.
| Compound Name | 2-[4-[(2-amino-1,3-thiazol-5-yl)oxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 140557880 |
| Molecular Formula | C11H10N2O3S |
| Molecular Weight | 250.28 g/mol |
| Exact Mass | 250.04 |
| IUPAC Name | 2-[4-[(2-amino-1,3-thiazol-5-yl)oxy]phenyl]acetic acid |
| SMILES | Nc1ncc(Oc2ccc(CC(=O)O)cc2)s1 |
| InChI | InChI=1S/C11H10N2O3S/c12-11-13-6-10(17-11)16-8-3-1-7(2-4-8)5-9(14)15/h1-4,6H,5H2,(H2,12,13)(H,14,15) |
| InChIKey | GHBDWLCOOIFLQC-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 85.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.28 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |