C14H10N2O3S — CID 61395524
2-(4-thieno[2,3-d]pyrimidin-4-yloxyphenyl)acetic acid (PubChem CID 61395524) has the molecular formula C14H10N2O3S and a molecular weight of 286.31 g/mol. Its IUPAC name is 2-(4-thieno[2,3-d]pyrimidin-4-yloxyphenyl)acetic acid.
| Compound Name | 2-(4-thieno[2,3-d]pyrimidin-4-yloxyphenyl)acetic acid |
|---|---|
| PubChem CID | 61395524 |
| Molecular Formula | C14H10N2O3S |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | 2-(4-thieno[2,3-d]pyrimidin-4-yloxyphenyl)acetic acid |
| SMILES | O=C(O)Cc1ccc(Oc2ncnc3sccc23)cc1 |
| InChI | InChI=1S/C14H10N2O3S/c17-12(18)7-9-1-3-10(4-2-9)19-13-11-5-6-20-14(11)16-8-15-13/h1-6,8H,7H2,(H,17,18) |
| InChIKey | LYBQGFLVWPSXKA-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |