C8H6N2O3S — CID 115596203
2-thieno[2,3-d]pyrimidin-4-yloxyacetic acid (PubChem CID 115596203) has the molecular formula C8H6N2O3S and a molecular weight of 210.21 g/mol. Its IUPAC name is 2-thieno[2,3-d]pyrimidin-4-yloxyacetic acid.
| Compound Name | 2-thieno[2,3-d]pyrimidin-4-yloxyacetic acid |
|---|---|
| PubChem CID | 115596203 |
| Molecular Formula | C8H6N2O3S |
| Molecular Weight | 210.21 g/mol |
| Exact Mass | 210.01 |
| IUPAC Name | 2-thieno[2,3-d]pyrimidin-4-yloxyacetic acid |
| SMILES | O=C(O)COc1ncnc2sccc12 |
| InChI | InChI=1S/C8H6N2O3S/c11-6(12)3-13-7-5-1-2-14-8(5)10-4-9-7/h1-2,4H,3H2,(H,11,12) |
| InChIKey | UMAVEBDOYPEIRU-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.21 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |