2-methyl-4-thieno[2,3-d]pyrimidin-4-yloxybenzoic acid

C14H10N2O3S — CID 107672534

IUPAC2-methyl-4-thieno[2,3-d]pyrimidin-4-yloxybenzoic acid
SMILESCc1cc(Oc2ncnc3sccc23)ccc1C(=O)O
InChIInChI=1S/C14H10N2O3S/c1-8-6-9(2-3-10(8)14(17)18)19-12-11-4-5-20-13(11)16-7-15-12/h2-7H,1H3,(H,17,18)
InChIKeyIJSJNHFWIPDFNO-UHFFFAOYSA-N
MW286.31 g/mol
LogP3.49
Rot. Bonds3

About 2-methyl-4-thieno[2,3-d]pyrimidin-4-yloxybenzoic acid

2-methyl-4-thieno[2,3-d]pyrimidin-4-yloxybenzoic acid (PubChem CID 107672534) has the molecular formula C14H10N2O3S and a molecular weight of 286.31 g/mol. Its IUPAC name is 2-methyl-4-thieno[2,3-d]pyrimidin-4-yloxybenzoic acid.

Molecular Properties

Compound Name2-methyl-4-thieno[2,3-d]pyrimidin-4-yloxybenzoic acid
PubChem CID107672534
Molecular FormulaC14H10N2O3S
Molecular Weight286.31 g/mol
Exact Mass286.04
IUPAC Name2-methyl-4-thieno[2,3-d]pyrimidin-4-yloxybenzoic acid
SMILESCc1cc(Oc2ncnc3sccc23)ccc1C(=O)O
InChIInChI=1S/C14H10N2O3S/c1-8-6-9(2-3-10(8)14(17)18)19-12-11-4-5-20-13(11)16-7-15-12/h2-7H,1H3,(H,17,18)
InChIKeyIJSJNHFWIPDFNO-UHFFFAOYSA-N
XLogP3.49
TPSA72.31 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500286.31
LogP ≤ 53.49
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2-methyl-4-thieno[2,3-d]pyrimidin-4-yloxybenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methyl-4-thieno[2,3-d]pyrimidin-4-yloxybenzoic acid?
The IUPAC name of 2-methyl-4-thieno[2,3-d]pyrimidin-4-yloxybenzoic acid (CID 107672534) is 2-methyl-4-thieno[2,3-d]pyrimidin-4-yloxybenzoic acid.
What is the SMILES notation for 2-methyl-4-thieno[2,3-d]pyrimidin-4-yloxybenzoic acid?
The canonical SMILES for 2-methyl-4-thieno[2,3-d]pyrimidin-4-yloxybenzoic acid is Cc1cc(Oc2ncnc3sccc23)ccc1C(=O)O.
What is the InChIKey of 2-methyl-4-thieno[2,3-d]pyrimidin-4-yloxybenzoic acid?
The InChIKey is IJSJNHFWIPDFNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N2O3S/c1-8-6-9(2-3-10(8)14(17)18)19-12-11-4-5-20-13(11)16-7-15-12/h2-7H,1H3,(H,17,18).
What are the key properties of 2-methyl-4-thieno[2,3-d]pyrimidin-4-yloxybenzoic acid?
2-methyl-4-thieno[2,3-d]pyrimidin-4-yloxybenzoic acid has a molecular weight of 286.31 g/mol, XLogP of 3.49, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-thieno[2,3-d]pyrimidin-4-yloxybenzoic acid is sourced from PubChem (CID 107672534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).