C20H15N3O2S — CID 9110957
3-methyl-N-(4-thieno[2,3-d]pyrimidin-4-yloxyphenyl)benzamide (PubChem CID 9110957) has the molecular formula C20H15N3O2S and a molecular weight of 361.43 g/mol. Its IUPAC name is 3-methyl-N-(4-thieno[2,3-d]pyrimidin-4-yloxyphenyl)benzamide.
| Compound Name | 3-methyl-N-(4-thieno[2,3-d]pyrimidin-4-yloxyphenyl)benzamide |
|---|---|
| PubChem CID | 9110957 |
| Molecular Formula | C20H15N3O2S |
| Molecular Weight | 361.43 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | 3-methyl-N-(4-thieno[2,3-d]pyrimidin-4-yloxyphenyl)benzamide |
| SMILES | Cc1cccc(C(=O)Nc2ccc(Oc3ncnc4sccc34)cc2)c1 |
| InChI | InChI=1S/C20H15N3O2S/c1-13-3-2-4-14(11-13)18(24)23-15-5-7-16(8-6-15)25-19-17-9-10-26-20(17)22-12-21-19/h2-12H,1H3,(H,23,24) |
| InChIKey | UTIGOFXRDHOYIU-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.43 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |