C16H15N3O2S — CID 2705201
N-(2,6-dimethylphenyl)-2-thieno[2,3-d]pyrimidin-4-yloxyacetamide (PubChem CID 2705201) has the molecular formula C16H15N3O2S and a molecular weight of 313.38 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-thieno[2,3-d]pyrimidin-4-yloxyacetamide.
| Compound Name | N-(2,6-dimethylphenyl)-2-thieno[2,3-d]pyrimidin-4-yloxyacetamide |
|---|---|
| PubChem CID | 2705201 |
| Molecular Formula | C16H15N3O2S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-thieno[2,3-d]pyrimidin-4-yloxyacetamide |
| SMILES | Cc1cccc(C)c1NC(=O)COc1ncnc2sccc12 |
| InChI | InChI=1S/C16H15N3O2S/c1-10-4-3-5-11(2)14(10)19-13(20)8-21-15-12-6-7-22-16(12)18-9-17-15/h3-7,9H,8H2,1-2H3,(H,19,20) |
| InChIKey | IEEFERQKIIYNDQ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |