C18H16F3N3O4S — CID 5217799
N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]-2-thieno[2,3-d]pyrimidin-4-yloxyacetamide (PubChem CID 5217799) has the molecular formula C18H16F3N3O4S and a molecular weight of 427.40 g/mol. Its IUPAC name is N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]-2-thieno[2,3-d]pyrimidin-4-yloxyacetamide.
| Compound Name | N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]-2-thieno[2,3-d]pyrimidin-4-yloxyacetamide |
|---|---|
| PubChem CID | 5217799 |
| Molecular Formula | C18H16F3N3O4S |
| Molecular Weight | 427.40 g/mol |
| Exact Mass | 427.08 |
| IUPAC Name | N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]-2-thieno[2,3-d]pyrimidin-4-yloxyacetamide |
| SMILES | COCCOc1ccc(C(F)(F)F)cc1NC(=O)COc1ncnc2sccc12 |
| InChI | InChI=1S/C18H16F3N3O4S/c1-26-5-6-27-14-3-2-11(18(19,20)21)8-13(14)24-15(25)9-28-16-12-4-7-29-17(12)23-10-22-16/h2-4,7-8,10H,5-6,9H2,1H3,(H,24,25) |
| InChIKey | SZLSOUCNKNFPQF-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.40 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|