C14H13N3OS — CID 63181014
2,5-dimethyl-4-thieno[2,3-d]pyrimidin-4-yloxyaniline (PubChem CID 63181014) has the molecular formula C14H13N3OS and a molecular weight of 271.34 g/mol. Its IUPAC name is 2,5-dimethyl-4-thieno[2,3-d]pyrimidin-4-yloxyaniline.
| Compound Name | 2,5-dimethyl-4-thieno[2,3-d]pyrimidin-4-yloxyaniline |
|---|---|
| PubChem CID | 63181014 |
| Molecular Formula | C14H13N3OS |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 2,5-dimethyl-4-thieno[2,3-d]pyrimidin-4-yloxyaniline |
| SMILES | Cc1cc(Oc2ncnc3sccc23)c(C)cc1N |
| InChI | InChI=1S/C14H13N3OS/c1-8-6-12(9(2)5-11(8)15)18-13-10-3-4-19-14(10)17-7-16-13/h3-7H,15H2,1-2H3 |
| InChIKey | YSAFXZKNCXCWQV-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|