About N-methyl-1-(4-thieno[2,3-d]pyrimidin-4-yloxyphenyl)methanamine
N-methyl-1-(4-thieno[2,3-d]pyrimidin-4-yloxyphenyl)methanamine (PubChem CID 106486840) has the molecular formula C14H13N3OS
and a molecular weight of 271.35 g/mol. Its IUPAC name is N-methyl-1-(4-thieno[2,3-d]pyrimidin-4-yloxyphenyl)methanamine.
Molecular Properties
| Compound Name | N-methyl-1-(4-thieno[2,3-d]pyrimidin-4-yloxyphenyl)methanamine |
| PubChem CID | 106486840 |
| Molecular Formula | C14H13N3OS |
| Molecular Weight | 271.35 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | N-methyl-1-(4-thieno[2,3-d]pyrimidin-4-yloxyphenyl)methanamine |
| SMILES | CNCc1ccc(Oc2ncnc3sccc23)cc1 |
| InChI | InChI=1S/C14H13N3OS/c1-15-8-10-2-4-11(5-3-10)18-13-12-6-7-19-14(12)17-9-16-13/h2-7,9,15H,8H2,1H3 |
| InChIKey | DURSRPXCEBDNIB-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.35 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-methyl-1-(4-thieno[2,3-d]pyrimidin-4-yloxyphenyl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1-(4-thieno[2,3-d]pyrimidin-4-yloxyphenyl)methanamine?
The IUPAC name of N-methyl-1-(4-thieno[2,3-d]pyrimidin-4-yloxyphenyl)methanamine (CID 106486840) is N-methyl-1-(4-thieno[2,3-d]pyrimidin-4-yloxyphenyl)methanamine.
What is the SMILES notation for N-methyl-1-(4-thieno[2,3-d]pyrimidin-4-yloxyphenyl)methanamine?
The canonical SMILES for N-methyl-1-(4-thieno[2,3-d]pyrimidin-4-yloxyphenyl)methanamine is CNCc1ccc(Oc2ncnc3sccc23)cc1.
What is the InChIKey of N-methyl-1-(4-thieno[2,3-d]pyrimidin-4-yloxyphenyl)methanamine?
The InChIKey is DURSRPXCEBDNIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N3OS/c1-15-8-10-2-4-11(5-3-10)18-13-12-6-7-19-14(12)17-9-16-13/h2-7,9,15H,8H2,1H3.
What are the key properties of N-methyl-1-(4-thieno[2,3-d]pyrimidin-4-yloxyphenyl)methanamine?
N-methyl-1-(4-thieno[2,3-d]pyrimidin-4-yloxyphenyl)methanamine has a molecular weight of 271.35 g/mol, XLogP of 3.20, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1-(4-thieno[2,3-d]pyrimidin-4-yloxyphenyl)methanamine is sourced from PubChem (CID 106486840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).