About N-methyl-2-thieno[2,3-d]pyrimidin-4-yloxypropan-1-amine
N-methyl-2-thieno[2,3-d]pyrimidin-4-yloxypropan-1-amine (PubChem CID 62349476) has the molecular formula C10H13N3OS
and a molecular weight of 223.30 g/mol. Its IUPAC name is N-methyl-2-thieno[2,3-d]pyrimidin-4-yloxypropan-1-amine.
Molecular Properties
| Compound Name | N-methyl-2-thieno[2,3-d]pyrimidin-4-yloxypropan-1-amine |
| PubChem CID | 62349476 |
| Molecular Formula | C10H13N3OS |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | N-methyl-2-thieno[2,3-d]pyrimidin-4-yloxypropan-1-amine |
| SMILES | CNCC(C)Oc1ncnc2sccc12 |
| InChI | InChI=1S/C10H13N3OS/c1-7(5-11-2)14-9-8-3-4-15-10(8)13-6-12-9/h3-4,6-7,11H,5H2,1-2H3 |
| InChIKey | ZGKZSOJNHKJQIA-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-methyl-2-thieno[2,3-d]pyrimidin-4-yloxypropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-2-thieno[2,3-d]pyrimidin-4-yloxypropan-1-amine?
The IUPAC name of N-methyl-2-thieno[2,3-d]pyrimidin-4-yloxypropan-1-amine (CID 62349476) is N-methyl-2-thieno[2,3-d]pyrimidin-4-yloxypropan-1-amine.
What is the SMILES notation for N-methyl-2-thieno[2,3-d]pyrimidin-4-yloxypropan-1-amine?
The canonical SMILES for N-methyl-2-thieno[2,3-d]pyrimidin-4-yloxypropan-1-amine is CNCC(C)Oc1ncnc2sccc12.
What is the InChIKey of N-methyl-2-thieno[2,3-d]pyrimidin-4-yloxypropan-1-amine?
The InChIKey is ZGKZSOJNHKJQIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3OS/c1-7(5-11-2)14-9-8-3-4-15-10(8)13-6-12-9/h3-4,6-7,11H,5H2,1-2H3.
What are the key properties of N-methyl-2-thieno[2,3-d]pyrimidin-4-yloxypropan-1-amine?
N-methyl-2-thieno[2,3-d]pyrimidin-4-yloxypropan-1-amine has a molecular weight of 223.30 g/mol, XLogP of 1.68, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-2-thieno[2,3-d]pyrimidin-4-yloxypropan-1-amine is sourced from PubChem (CID 62349476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).