C11H14N2OS — CID 62348077
N-methyl-2-thieno[3,2-c]pyridin-4-yloxypropan-1-amine (PubChem CID 62348077) has the molecular formula C11H14N2OS and a molecular weight of 222.31 g/mol. Its IUPAC name is N-methyl-2-thieno[3,2-c]pyridin-4-yloxypropan-1-amine.
| Compound Name | N-methyl-2-thieno[3,2-c]pyridin-4-yloxypropan-1-amine |
|---|---|
| PubChem CID | 62348077 |
| Molecular Formula | C11H14N2OS |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | N-methyl-2-thieno[3,2-c]pyridin-4-yloxypropan-1-amine |
| SMILES | CNCC(C)Oc1nccc2sccc12 |
| InChI | InChI=1S/C11H14N2OS/c1-8(7-12-2)14-11-9-4-6-15-10(9)3-5-13-11/h3-6,8,12H,7H2,1-2H3 |
| InChIKey | SFPLAIDSPHOYNS-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |