C9H8BrNS — CID 70376593
4-(1-bromoethyl)thieno[3,2-c]pyridine (PubChem CID 70376593) has the molecular formula C9H8BrNS and a molecular weight of 242.14 g/mol. Its IUPAC name is 4-(1-bromoethyl)thieno[3,2-c]pyridine.
| Compound Name | 4-(1-bromoethyl)thieno[3,2-c]pyridine |
|---|---|
| PubChem CID | 70376593 |
| Molecular Formula | C9H8BrNS |
| Molecular Weight | 242.14 g/mol |
| Exact Mass | 240.96 |
| IUPAC Name | 4-(1-bromoethyl)thieno[3,2-c]pyridine |
| SMILES | CC(Br)c1nccc2sccc12 |
| InChI | InChI=1S/C9H8BrNS/c1-6(10)9-7-3-5-12-8(7)2-4-11-9/h2-6H,1H3 |
| InChIKey | VBDCTVJHEKLTFI-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.14 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|