C9H7NOS — CID 130047659
1-thieno[3,2-c]pyridin-4-ylethanone (PubChem CID 130047659) has the molecular formula C9H7NOS and a molecular weight of 177.23 g/mol. Its IUPAC name is 1-thieno[3,2-c]pyridin-4-ylethanone.
| Compound Name | 1-thieno[3,2-c]pyridin-4-ylethanone |
|---|---|
| PubChem CID | 130047659 |
| Molecular Formula | C9H7NOS |
| Molecular Weight | 177.23 g/mol |
| Exact Mass | 177.02 |
| IUPAC Name | 1-thieno[3,2-c]pyridin-4-ylethanone |
| SMILES | CC(=O)c1nccc2sccc12 |
| InChI | InChI=1S/C9H7NOS/c1-6(11)9-7-3-5-12-8(7)2-4-10-9/h2-5H,1H3 |
| InChIKey | WQNWPRHKCWUPRJ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.23 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |