About 4-(1-ethoxyethenyl)thieno[3,2-c]pyridine
4-(1-ethoxyethenyl)thieno[3,2-c]pyridine (PubChem CID 135337046) has the molecular formula C11H11NOS
and a molecular weight of 205.28 g/mol. Its IUPAC name is 4-(1-ethoxyethenyl)thieno[3,2-c]pyridine.
Molecular Properties
| Compound Name | 4-(1-ethoxyethenyl)thieno[3,2-c]pyridine |
| PubChem CID | 135337046 |
| Molecular Formula | C11H11NOS |
| Molecular Weight | 205.28 g/mol |
| Exact Mass | 205.06 |
| IUPAC Name | 4-(1-ethoxyethenyl)thieno[3,2-c]pyridine |
| SMILES | C=C(OCC)c1nccc2sccc12 |
| InChI | InChI=1S/C11H11NOS/c1-3-13-8(2)11-9-5-7-14-10(9)4-6-12-11/h4-7H,2-3H2,1H3 |
| InChIKey | VNOHTLYCFUTGGB-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.28 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 4-(1-ethoxyethenyl)thieno[3,2-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-ethoxyethenyl)thieno[3,2-c]pyridine?
The IUPAC name of 4-(1-ethoxyethenyl)thieno[3,2-c]pyridine (CID 135337046) is 4-(1-ethoxyethenyl)thieno[3,2-c]pyridine.
What is the SMILES notation for 4-(1-ethoxyethenyl)thieno[3,2-c]pyridine?
The canonical SMILES for 4-(1-ethoxyethenyl)thieno[3,2-c]pyridine is C=C(OCC)c1nccc2sccc12.
What is the InChIKey of 4-(1-ethoxyethenyl)thieno[3,2-c]pyridine?
The InChIKey is VNOHTLYCFUTGGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NOS/c1-3-13-8(2)11-9-5-7-14-10(9)4-6-12-11/h4-7H,2-3H2,1H3.
What are the key properties of 4-(1-ethoxyethenyl)thieno[3,2-c]pyridine?
4-(1-ethoxyethenyl)thieno[3,2-c]pyridine has a molecular weight of 205.28 g/mol, XLogP of 3.30, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-ethoxyethenyl)thieno[3,2-c]pyridine is sourced from PubChem (CID 135337046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).