C11H11NOS — CID 135337046
4-(1-ethoxyethenyl)thieno[3,2-c]pyridine (PubChem CID 135337046) has the molecular formula C11H11NOS and a molecular weight of 205.28 g/mol. Its IUPAC name is 4-(1-ethoxyethenyl)thieno[3,2-c]pyridine.
| Compound Name | 4-(1-ethoxyethenyl)thieno[3,2-c]pyridine |
|---|---|
| PubChem CID | 135337046 |
| Molecular Formula | C11H11NOS |
| Molecular Weight | 205.28 g/mol |
| Exact Mass | 205.06 |
| IUPAC Name | 4-(1-ethoxyethenyl)thieno[3,2-c]pyridine |
| SMILES | C=C(OCC)c1nccc2sccc12 |
| InChI | InChI=1S/C11H11NOS/c1-3-13-8(2)11-9-5-7-14-10(9)4-6-12-11/h4-7H,2-3H2,1H3 |
| InChIKey | VNOHTLYCFUTGGB-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.28 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|