C12H16N2OS — CID 61425977
2-[propyl(thieno[3,2-c]pyridin-4-yl)amino]ethanol (PubChem CID 61425977) has the molecular formula C12H16N2OS and a molecular weight of 236.34 g/mol. Its IUPAC name is 2-[propyl(thieno[3,2-c]pyridin-4-yl)amino]ethanol.
| Compound Name | 2-[propyl(thieno[3,2-c]pyridin-4-yl)amino]ethanol |
|---|---|
| PubChem CID | 61425977 |
| Molecular Formula | C12H16N2OS |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 2-[propyl(thieno[3,2-c]pyridin-4-yl)amino]ethanol |
| SMILES | CCCN(CCO)c1nccc2sccc12 |
| InChI | InChI=1S/C12H16N2OS/c1-2-6-14(7-8-15)12-10-4-9-16-11(10)3-5-13-12/h3-5,9,15H,2,6-8H2,1H3 |
| InChIKey | BLNAWUAVOWIWBR-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |