C12H14N2O2S — CID 43522697
4-[methyl(thieno[3,2-c]pyridin-4-yl)amino]butanoic acid (PubChem CID 43522697) has the molecular formula C12H14N2O2S and a molecular weight of 250.32 g/mol. Its IUPAC name is 4-[methyl(thieno[3,2-c]pyridin-4-yl)amino]butanoic acid.
| Compound Name | 4-[methyl(thieno[3,2-c]pyridin-4-yl)amino]butanoic acid |
|---|---|
| PubChem CID | 43522697 |
| Molecular Formula | C12H14N2O2S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 4-[methyl(thieno[3,2-c]pyridin-4-yl)amino]butanoic acid |
| SMILES | CN(CCCC(=O)O)c1nccc2sccc12 |
| InChI | InChI=1S/C12H14N2O2S/c1-14(7-2-3-11(15)16)12-9-5-8-17-10(9)4-6-13-12/h4-6,8H,2-3,7H2,1H3,(H,15,16) |
| InChIKey | VSZZBLWLGYTGEI-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |