About 4-(4-oxothieno[3,2-c]pyridin-5-yl)butanoic acid
4-(4-oxothieno[3,2-c]pyridin-5-yl)butanoic acid (PubChem CID 112556973) has the molecular formula C11H11NO3S
and a molecular weight of 237.28 g/mol. Its IUPAC name is 4-(4-oxothieno[3,2-c]pyridin-5-yl)butanoic acid.
Molecular Properties
| Compound Name | 4-(4-oxothieno[3,2-c]pyridin-5-yl)butanoic acid |
| PubChem CID | 112556973 |
| Molecular Formula | C11H11NO3S |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.05 |
| IUPAC Name | 4-(4-oxothieno[3,2-c]pyridin-5-yl)butanoic acid |
| SMILES | O=C(O)CCCn1ccc2sccc2c1=O |
| InChI | InChI=1S/C11H11NO3S/c13-10(14)2-1-5-12-6-3-9-8(11(12)15)4-7-16-9/h3-4,6-7H,1-2,5H2,(H,13,14) |
| InChIKey | FELHMZAGWJPACN-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(4-oxothieno[3,2-c]pyridin-5-yl)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-oxothieno[3,2-c]pyridin-5-yl)butanoic acid?
The IUPAC name of 4-(4-oxothieno[3,2-c]pyridin-5-yl)butanoic acid (CID 112556973) is 4-(4-oxothieno[3,2-c]pyridin-5-yl)butanoic acid.
What is the SMILES notation for 4-(4-oxothieno[3,2-c]pyridin-5-yl)butanoic acid?
The canonical SMILES for 4-(4-oxothieno[3,2-c]pyridin-5-yl)butanoic acid is O=C(O)CCCn1ccc2sccc2c1=O.
What is the InChIKey of 4-(4-oxothieno[3,2-c]pyridin-5-yl)butanoic acid?
The InChIKey is FELHMZAGWJPACN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO3S/c13-10(14)2-1-5-12-6-3-9-8(11(12)15)4-7-16-9/h3-4,6-7H,1-2,5H2,(H,13,14).
What are the key properties of 4-(4-oxothieno[3,2-c]pyridin-5-yl)butanoic acid?
4-(4-oxothieno[3,2-c]pyridin-5-yl)butanoic acid has a molecular weight of 237.28 g/mol, XLogP of 1.93, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-oxothieno[3,2-c]pyridin-5-yl)butanoic acid is sourced from PubChem (CID 112556973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).