C16H16N2O2S — CID 115911999
5-[3-(3-aminophenoxy)propyl]thieno[3,2-c]pyridin-4-one (PubChem CID 115911999) has the molecular formula C16H16N2O2S and a molecular weight of 300.38 g/mol. Its IUPAC name is 5-[3-(3-aminophenoxy)propyl]thieno[3,2-c]pyridin-4-one.
| Compound Name | 5-[3-(3-aminophenoxy)propyl]thieno[3,2-c]pyridin-4-one |
|---|---|
| PubChem CID | 115911999 |
| Molecular Formula | C16H16N2O2S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 5-[3-(3-aminophenoxy)propyl]thieno[3,2-c]pyridin-4-one |
| SMILES | Nc1cccc(OCCCn2ccc3sccc3c2=O)c1 |
| InChI | InChI=1S/C16H16N2O2S/c17-12-3-1-4-13(11-12)20-9-2-7-18-8-5-15-14(16(18)19)6-10-21-15/h1,3-6,8,10-11H,2,7,9,17H2 |
| InChIKey | NNXMHXBECRMKSN-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|