C16H23NOS2 — CID 105344666
5-(9-sulfanylnonyl)thieno[3,2-c]pyridin-4-one (PubChem CID 105344666) has the molecular formula C16H23NOS2 and a molecular weight of 309.50 g/mol. Its IUPAC name is 5-(9-sulfanylnonyl)thieno[3,2-c]pyridin-4-one.
| Compound Name | 5-(9-sulfanylnonyl)thieno[3,2-c]pyridin-4-one |
|---|---|
| PubChem CID | 105344666 |
| Molecular Formula | C16H23NOS2 |
| Molecular Weight | 309.50 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | 5-(9-sulfanylnonyl)thieno[3,2-c]pyridin-4-one |
| SMILES | O=c1c2ccsc2ccn1CCCCCCCCCS |
| InChI | InChI=1S/C16H23NOS2/c18-16-14-9-13-20-15(14)8-11-17(16)10-6-4-2-1-3-5-7-12-19/h8-9,11,13,19H,1-7,10,12H2 |
| InChIKey | MCWZWSLKKZYTJA-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 22.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.50 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|