C8H14N2OS — CID 61425727
2-[propyl(1,3-thiazol-2-yl)amino]ethanol (PubChem CID 61425727) has the molecular formula C8H14N2OS and a molecular weight of 186.28 g/mol. Its IUPAC name is 2-[propyl(1,3-thiazol-2-yl)amino]ethanol.
| Compound Name | 2-[propyl(1,3-thiazol-2-yl)amino]ethanol |
|---|---|
| PubChem CID | 61425727 |
| Molecular Formula | C8H14N2OS |
| Molecular Weight | 186.28 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | 2-[propyl(1,3-thiazol-2-yl)amino]ethanol |
| SMILES | CCCN(CCO)c1nccs1 |
| InChI | InChI=1S/C8H14N2OS/c1-2-4-10(5-6-11)8-9-3-7-12-8/h3,7,11H,2,4-6H2,1H3 |
| InChIKey | LTAROJOAZGFQRX-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.28 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |