C9H14N2O2S — CID 62854028
3-[ethyl(1,3-thiazol-2-yl)amino]-2-methylpropanoic acid (PubChem CID 62854028) has the molecular formula C9H14N2O2S and a molecular weight of 214.29 g/mol. Its IUPAC name is 3-[ethyl(1,3-thiazol-2-yl)amino]-2-methylpropanoic acid.
| Compound Name | 3-[ethyl(1,3-thiazol-2-yl)amino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 62854028 |
| Molecular Formula | C9H14N2O2S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 3-[ethyl(1,3-thiazol-2-yl)amino]-2-methylpropanoic acid |
| SMILES | CCN(CC(C)C(=O)O)c1nccs1 |
| InChI | InChI=1S/C9H14N2O2S/c1-3-11(6-7(2)8(12)13)9-10-4-5-14-9/h4-5,7H,3,6H2,1-2H3,(H,12,13) |
| InChIKey | UAFTZEPEWAUFHW-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |