About N'-(2-methylpropyl)-N'-thieno[3,2-c]pyridin-4-ylethane-1,2-diamine
N'-(2-methylpropyl)-N'-thieno[3,2-c]pyridin-4-ylethane-1,2-diamine (PubChem CID 62587629) has the molecular formula C13H19N3S
and a molecular weight of 249.38 g/mol. Its IUPAC name is N'-(2-methylpropyl)-N'-thieno[3,2-c]pyridin-4-ylethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-(2-methylpropyl)-N'-thieno[3,2-c]pyridin-4-ylethane-1,2-diamine |
| PubChem CID | 62587629 |
| Molecular Formula | C13H19N3S |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | N'-(2-methylpropyl)-N'-thieno[3,2-c]pyridin-4-ylethane-1,2-diamine |
| SMILES | CC(C)CN(CCN)c1nccc2sccc12 |
| InChI | InChI=1S/C13H19N3S/c1-10(2)9-16(7-5-14)13-11-4-8-17-12(11)3-6-15-13/h3-4,6,8,10H,5,7,9,14H2,1-2H3 |
| InChIKey | ZKHZVLZEXDDJRL-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N'-(2-methylpropyl)-N'-thieno[3,2-c]pyridin-4-ylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2-methylpropyl)-N'-thieno[3,2-c]pyridin-4-ylethane-1,2-diamine?
The IUPAC name of N'-(2-methylpropyl)-N'-thieno[3,2-c]pyridin-4-ylethane-1,2-diamine (CID 62587629) is N'-(2-methylpropyl)-N'-thieno[3,2-c]pyridin-4-ylethane-1,2-diamine.
What is the SMILES notation for N'-(2-methylpropyl)-N'-thieno[3,2-c]pyridin-4-ylethane-1,2-diamine?
The canonical SMILES for N'-(2-methylpropyl)-N'-thieno[3,2-c]pyridin-4-ylethane-1,2-diamine is CC(C)CN(CCN)c1nccc2sccc12.
What is the InChIKey of N'-(2-methylpropyl)-N'-thieno[3,2-c]pyridin-4-ylethane-1,2-diamine?
The InChIKey is ZKHZVLZEXDDJRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3S/c1-10(2)9-16(7-5-14)13-11-4-8-17-12(11)3-6-15-13/h3-4,6,8,10H,5,7,9,14H2,1-2H3.
What are the key properties of N'-(2-methylpropyl)-N'-thieno[3,2-c]pyridin-4-ylethane-1,2-diamine?
N'-(2-methylpropyl)-N'-thieno[3,2-c]pyridin-4-ylethane-1,2-diamine has a molecular weight of 249.38 g/mol, XLogP of 2.72, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2-methylpropyl)-N'-thieno[3,2-c]pyridin-4-ylethane-1,2-diamine is sourced from PubChem (CID 62587629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).