C13H19N3OS — CID 62586554
N-(2-methoxyethyl)-N'-methyl-N'-thieno[3,2-c]pyridin-4-ylethane-1,2-diamine (PubChem CID 62586554) has the molecular formula C13H19N3OS and a molecular weight of 265.38 g/mol. Its IUPAC name is N-(2-methoxyethyl)-N'-methyl-N'-thieno[3,2-c]pyridin-4-ylethane-1,2-diamine.
| Compound Name | N-(2-methoxyethyl)-N'-methyl-N'-thieno[3,2-c]pyridin-4-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 62586554 |
| Molecular Formula | C13H19N3OS |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | N-(2-methoxyethyl)-N'-methyl-N'-thieno[3,2-c]pyridin-4-ylethane-1,2-diamine |
| SMILES | COCCNCCN(C)c1nccc2sccc12 |
| InChI | InChI=1S/C13H19N3OS/c1-16(8-6-14-7-9-17-2)13-11-4-10-18-12(11)3-5-15-13/h3-5,10,14H,6-9H2,1-2H3 |
| InChIKey | ZXNGFDSUZBVAGP-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|