C10H17IN4O — CID 66320006
N'-(5-iodopyrimidin-4-yl)-N-(2-methoxyethyl)-N'-methylethane-1,2-diamine (PubChem CID 66320006) has the molecular formula C10H17IN4O and a molecular weight of 336.18 g/mol. Its IUPAC name is N'-(5-iodopyrimidin-4-yl)-N-(2-methoxyethyl)-N'-methylethane-1,2-diamine.
| Compound Name | N'-(5-iodopyrimidin-4-yl)-N-(2-methoxyethyl)-N'-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 66320006 |
| Molecular Formula | C10H17IN4O |
| Molecular Weight | 336.18 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | N'-(5-iodopyrimidin-4-yl)-N-(2-methoxyethyl)-N'-methylethane-1,2-diamine |
| SMILES | COCCNCCN(C)c1ncncc1I |
| InChI | InChI=1S/C10H17IN4O/c1-15(5-3-12-4-6-16-2)10-9(11)7-13-8-14-10/h7-8,12H,3-6H2,1-2H3 |
| InChIKey | FHXBSCCAIXVIGB-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.18 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|