C11H19N3O — CID 62588167
N-(2-methoxyethyl)-N'-methyl-N'-pyridin-2-ylethane-1,2-diamine (PubChem CID 62588167) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is N-(2-methoxyethyl)-N'-methyl-N'-pyridin-2-ylethane-1,2-diamine.
| Compound Name | N-(2-methoxyethyl)-N'-methyl-N'-pyridin-2-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 62588167 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | N-(2-methoxyethyl)-N'-methyl-N'-pyridin-2-ylethane-1,2-diamine |
| SMILES | COCCNCCN(C)c1ccccn1 |
| InChI | InChI=1S/C11H19N3O/c1-14(9-7-12-8-10-15-2)11-5-3-4-6-13-11/h3-6,12H,7-10H2,1-2H3 |
| InChIKey | ABPGLBOPDCPECL-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|