C13H24N4O2 — CID 112639113
N-(2-methoxyethyl)-N'-methyl-N'-(4-propoxypyrimidin-2-yl)ethane-1,2-diamine (PubChem CID 112639113) has the molecular formula C13H24N4O2 and a molecular weight of 268.36 g/mol. Its IUPAC name is N-(2-methoxyethyl)-N'-methyl-N'-(4-propoxypyrimidin-2-yl)ethane-1,2-diamine.
| Compound Name | N-(2-methoxyethyl)-N'-methyl-N'-(4-propoxypyrimidin-2-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 112639113 |
| Molecular Formula | C13H24N4O2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | N-(2-methoxyethyl)-N'-methyl-N'-(4-propoxypyrimidin-2-yl)ethane-1,2-diamine |
| SMILES | CCCOc1ccnc(N(C)CCNCCOC)n1 |
| InChI | InChI=1S/C13H24N4O2/c1-4-10-19-12-5-6-15-13(16-12)17(2)9-7-14-8-11-18-3/h5-6,14H,4,7-11H2,1-3H3 |
| InChIKey | RYSBMQPISNACMZ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|