C13H19N3O2 — CID 62587636
N'-(1,3-benzoxazol-2-yl)-N-(2-methoxyethyl)-N'-methylethane-1,2-diamine (PubChem CID 62587636) has the molecular formula C13H19N3O2 and a molecular weight of 249.31 g/mol. Its IUPAC name is N'-(1,3-benzoxazol-2-yl)-N-(2-methoxyethyl)-N'-methylethane-1,2-diamine.
| Compound Name | N'-(1,3-benzoxazol-2-yl)-N-(2-methoxyethyl)-N'-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 62587636 |
| Molecular Formula | C13H19N3O2 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | N'-(1,3-benzoxazol-2-yl)-N-(2-methoxyethyl)-N'-methylethane-1,2-diamine |
| SMILES | COCCNCCN(C)c1nc2ccccc2o1 |
| InChI | InChI=1S/C13H19N3O2/c1-16(9-7-14-8-10-17-2)13-15-11-5-3-4-6-12(11)18-13/h3-6,14H,7-10H2,1-2H3 |
| InChIKey | NONIQZBGNARCFK-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 50.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|