C20H21IN2O4 — CID 23362209
methyl 3-[4-[2-[1,3-benzoxazol-2-yl(methyl)amino]ethoxy]phenyl]-2-iodopropanoate (PubChem CID 23362209) has the molecular formula C20H21IN2O4 and a molecular weight of 480.30 g/mol. Its IUPAC name is methyl 3-[4-[2-[1,3-benzoxazol-2-yl(methyl)amino]ethoxy]phenyl]-2-iodopropanoate.
| Compound Name | methyl 3-[4-[2-[1,3-benzoxazol-2-yl(methyl)amino]ethoxy]phenyl]-2-iodopropanoate |
|---|---|
| PubChem CID | 23362209 |
| Molecular Formula | C20H21IN2O4 |
| Molecular Weight | 480.30 g/mol |
| Exact Mass | 480.05 |
| IUPAC Name | methyl 3-[4-[2-[1,3-benzoxazol-2-yl(methyl)amino]ethoxy]phenyl]-2-iodopropanoate |
| SMILES | COC(=O)C(I)Cc1ccc(OCCN(C)c2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C20H21IN2O4/c1-23(20-22-17-5-3-4-6-18(17)27-20)11-12-26-15-9-7-14(8-10-15)13-16(21)19(24)25-2/h3-10,16H,11-13H2,1-2H3 |
| InChIKey | YWOAOWGVFKOSSN-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 64.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.30 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|