C22H25N3O5 — CID 72975980
2-[[3-[2-[1,3-benzoxazol-2-yl(methyl)amino]ethoxy]phenyl]methyl]-3-methoxyiminobutanoic acid (PubChem CID 72975980) has the molecular formula C22H25N3O5 and a molecular weight of 411.46 g/mol. Its IUPAC name is 2-[[3-[2-[1,3-benzoxazol-2-yl(methyl)amino]ethoxy]phenyl]methyl]-3-methoxyiminobutanoic acid.
| Compound Name | 2-[[3-[2-[1,3-benzoxazol-2-yl(methyl)amino]ethoxy]phenyl]methyl]-3-methoxyiminobutanoic acid |
|---|---|
| PubChem CID | 72975980 |
| Molecular Formula | C22H25N3O5 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 2-[[3-[2-[1,3-benzoxazol-2-yl(methyl)amino]ethoxy]phenyl]methyl]-3-methoxyiminobutanoic acid |
| SMILES | CON=C(C)C(Cc1cccc(OCCN(C)c2nc3ccccc3o2)c1)C(=O)O |
| InChI | InChI=1S/C22H25N3O5/c1-15(24-28-3)18(21(26)27)14-16-7-6-8-17(13-16)29-12-11-25(2)22-23-19-9-4-5-10-20(19)30-22/h4-10,13,18H,11-12,14H2,1-3H3,(H,26,27) |
| InChIKey | XKIGJAHWWDWFMQ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|