C34H33N3O5 — CID 57111554
methyl 3-[4-[2-[1,3-benzoxazol-2-yl(methyl)amino]ethoxy]phenyl]-2-(2-benzoyl-4-methylanilino)propanoate (PubChem CID 57111554) has the molecular formula C34H33N3O5 and a molecular weight of 563.65 g/mol. Its IUPAC name is methyl 3-[4-[2-[1,3-benzoxazol-2-yl(methyl)amino]ethoxy]phenyl]-2-(2-benzoyl-4-methylanilino)propanoate.
| Compound Name | methyl 3-[4-[2-[1,3-benzoxazol-2-yl(methyl)amino]ethoxy]phenyl]-2-(2-benzoyl-4-methylanilino)propanoate |
|---|---|
| PubChem CID | 57111554 |
| Molecular Formula | C34H33N3O5 |
| Molecular Weight | 563.65 g/mol |
| Exact Mass | 563.24 |
| IUPAC Name | methyl 3-[4-[2-[1,3-benzoxazol-2-yl(methyl)amino]ethoxy]phenyl]-2-(2-benzoyl-4-methylanilino)propanoate |
| SMILES | COC(=O)C(Cc1ccc(OCCN(C)c2nc3ccccc3o2)cc1)Nc1ccc(C)cc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C34H33N3O5/c1-23-13-18-28(27(21-23)32(38)25-9-5-4-6-10-25)35-30(33(39)40-3)22-24-14-16-26(17-15-24)41-20-19-37(2)34-36-29-11-7-8-12-31(29)42-34/h4-18,21,30,35H,19-20,22H2,1-3H3 |
| InChIKey | HVOGJDYFQVKDRS-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 93.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.65 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|