C33H27N3O4 — CID 11478082
(2S)-3-[4-[3-[1,3-benzoxazol-2-yl(methyl)amino]prop-1-ynyl]phenyl]-2-(2-benzoylanilino)propanoic acid (PubChem CID 11478082) has the molecular formula C33H27N3O4 and a molecular weight of 529.60 g/mol. Its IUPAC name is (2S)-3-[4-[3-[1,3-benzoxazol-2-yl(methyl)amino]prop-1-ynyl]phenyl]-2-(2-benzoylanilino)propanoic acid.
| Compound Name | (2S)-3-[4-[3-[1,3-benzoxazol-2-yl(methyl)amino]prop-1-ynyl]phenyl]-2-(2-benzoylanilino)propanoic acid |
|---|---|
| PubChem CID | 11478082 |
| Molecular Formula | C33H27N3O4 |
| Molecular Weight | 529.60 g/mol |
| Exact Mass | 529.20 |
| IUPAC Name | (2S)-3-[4-[3-[1,3-benzoxazol-2-yl(methyl)amino]prop-1-ynyl]phenyl]-2-(2-benzoylanilino)propanoic acid |
| SMILES | CN(CC#Cc1ccc(C[C@H](Nc2ccccc2C(=O)c2ccccc2)C(=O)O)cc1)c1nc2ccccc2o1 |
| InChI | InChI=1S/C33H27N3O4/c1-36(33-35-28-15-7-8-16-30(28)40-33)21-9-10-23-17-19-24(20-18-23)22-29(32(38)39)34-27-14-6-5-13-26(27)31(37)25-11-3-2-4-12-25/h2-8,11-20,29,34H,21-22H2,1H3,(H,38,39)/t29-/m0/s1 |
| InChIKey | ZGUMFJXQFWJVCD-LJAQVGFWSA-N |
| XLogP | 5.65 |
| TPSA | 95.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.60 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|