C33H31N3O6 — CID 54243240
3-[4-[2-(1,3-benzoxazol-2-ylmethylamino)ethoxy]phenyl]-2-[2-(3-methoxybenzoyl)anilino]propanoic acid (PubChem CID 54243240) has the molecular formula C33H31N3O6 and a molecular weight of 565.63 g/mol. Its IUPAC name is 3-[4-[2-(1,3-benzoxazol-2-ylmethylamino)ethoxy]phenyl]-2-[2-(3-methoxybenzoyl)anilino]propanoic acid.
| Compound Name | 3-[4-[2-(1,3-benzoxazol-2-ylmethylamino)ethoxy]phenyl]-2-[2-(3-methoxybenzoyl)anilino]propanoic acid |
|---|---|
| PubChem CID | 54243240 |
| Molecular Formula | C33H31N3O6 |
| Molecular Weight | 565.63 g/mol |
| Exact Mass | 565.22 |
| IUPAC Name | 3-[4-[2-(1,3-benzoxazol-2-ylmethylamino)ethoxy]phenyl]-2-[2-(3-methoxybenzoyl)anilino]propanoic acid |
| SMILES | COc1cccc(C(=O)c2ccccc2NC(Cc2ccc(OCCNCc3nc4ccccc4o3)cc2)C(=O)O)c1 |
| InChI | InChI=1S/C33H31N3O6/c1-40-25-8-6-7-23(20-25)32(37)26-9-2-3-10-27(26)35-29(33(38)39)19-22-13-15-24(16-14-22)41-18-17-34-21-31-36-28-11-4-5-12-30(28)42-31/h2-16,20,29,34-35H,17-19,21H2,1H3,(H,38,39) |
| InChIKey | QRLZKHFBBFSRDE-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 122.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.63 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|