C15H18N2O2S — CID 18399709
ethyl 4-thieno[3,2-c]pyridin-4-ylpiperidine-1-carboxylate (PubChem CID 18399709) has the molecular formula C15H18N2O2S and a molecular weight of 290.39 g/mol. Its IUPAC name is ethyl 4-thieno[3,2-c]pyridin-4-ylpiperidine-1-carboxylate.
| Compound Name | ethyl 4-thieno[3,2-c]pyridin-4-ylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 18399709 |
| Molecular Formula | C15H18N2O2S |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | ethyl 4-thieno[3,2-c]pyridin-4-ylpiperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(c2nccc3sccc23)CC1 |
| InChI | InChI=1S/C15H18N2O2S/c1-2-19-15(18)17-8-4-11(5-9-17)14-12-6-10-20-13(12)3-7-16-14/h3,6-7,10-11H,2,4-5,8-9H2,1H3 |
| InChIKey | NOYXZXMWWGPCOU-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |