C19H30N4O3 — CID 78318316
ethyl 4-[4-(4-methoxypyridazin-3-yl)piperidin-1-yl]azepane-1-carboxylate (PubChem CID 78318316) has the molecular formula C19H30N4O3 and a molecular weight of 362.47 g/mol. Its IUPAC name is ethyl 4-[4-(4-methoxypyridazin-3-yl)piperidin-1-yl]azepane-1-carboxylate.
| Compound Name | ethyl 4-[4-(4-methoxypyridazin-3-yl)piperidin-1-yl]azepane-1-carboxylate |
|---|---|
| PubChem CID | 78318316 |
| Molecular Formula | C19H30N4O3 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.23 |
| IUPAC Name | ethyl 4-[4-(4-methoxypyridazin-3-yl)piperidin-1-yl]azepane-1-carboxylate |
| SMILES | CCOC(=O)N1CCCC(N2CCC(c3nnccc3OC)CC2)CC1 |
| InChI | InChI=1S/C19H30N4O3/c1-3-26-19(24)23-11-4-5-16(9-14-23)22-12-7-15(8-13-22)18-17(25-2)6-10-20-21-18/h6,10,15-16H,3-5,7-9,11-14H2,1-2H3 |
| InChIKey | DXHZIRGJDHKXIZ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |