C18H28N4O2 — CID 78318381
ethyl 4-(4-pyrimidin-2-ylpiperidin-1-yl)azepane-1-carboxylate (PubChem CID 78318381) has the molecular formula C18H28N4O2 and a molecular weight of 332.45 g/mol. Its IUPAC name is ethyl 4-(4-pyrimidin-2-ylpiperidin-1-yl)azepane-1-carboxylate.
| Compound Name | ethyl 4-(4-pyrimidin-2-ylpiperidin-1-yl)azepane-1-carboxylate |
|---|---|
| PubChem CID | 78318381 |
| Molecular Formula | C18H28N4O2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | ethyl 4-(4-pyrimidin-2-ylpiperidin-1-yl)azepane-1-carboxylate |
| SMILES | CCOC(=O)N1CCCC(N2CCC(c3ncccn3)CC2)CC1 |
| InChI | InChI=1S/C18H28N4O2/c1-2-24-18(23)22-11-3-5-16(8-14-22)21-12-6-15(7-13-21)17-19-9-4-10-20-17/h4,9-10,15-16H,2-3,5-8,11-14H2,1H3 |
| InChIKey | CYONYIIVPRXNIB-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |