C18H27N3O2 — CID 78318993
ethyl 4-(4-pyridin-4-ylpiperidin-1-yl)piperidine-1-carboxylate (PubChem CID 78318993) has the molecular formula C18H27N3O2 and a molecular weight of 317.43 g/mol. Its IUPAC name is ethyl 4-(4-pyridin-4-ylpiperidin-1-yl)piperidine-1-carboxylate.
| Compound Name | ethyl 4-(4-pyridin-4-ylpiperidin-1-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 78318993 |
| Molecular Formula | C18H27N3O2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | ethyl 4-(4-pyridin-4-ylpiperidin-1-yl)piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N2CCC(c3ccncc3)CC2)CC1 |
| InChI | InChI=1S/C18H27N3O2/c1-2-23-18(22)21-13-7-17(8-14-21)20-11-5-16(6-12-20)15-3-9-19-10-4-15/h3-4,9-10,16-17H,2,5-8,11-14H2,1H3 |
| InChIKey | UIZFWMBMVXYYQQ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |