C23H30N2O2 — CID 24770902
ethyl 4-(4-naphthalen-1-ylpiperidin-1-yl)piperidine-1-carboxylate (PubChem CID 24770902) has the molecular formula C23H30N2O2 and a molecular weight of 366.50 g/mol. Its IUPAC name is ethyl 4-(4-naphthalen-1-ylpiperidin-1-yl)piperidine-1-carboxylate.
| Compound Name | ethyl 4-(4-naphthalen-1-ylpiperidin-1-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 24770902 |
| Molecular Formula | C23H30N2O2 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | ethyl 4-(4-naphthalen-1-ylpiperidin-1-yl)piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N2CCC(c3cccc4ccccc34)CC2)CC1 |
| InChI | InChI=1S/C23H30N2O2/c1-2-27-23(26)25-16-12-20(13-17-25)24-14-10-19(11-15-24)22-9-5-7-18-6-3-4-8-21(18)22/h3-9,19-20H,2,10-17H2,1H3 |
| InChIKey | HWGJTDVVEGTXQW-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |