C18H27N3O4S — CID 1151828
ethyl 4-[4-(benzenesulfonyl)piperazin-1-yl]piperidine-1-carboxylate (PubChem CID 1151828) has the molecular formula C18H27N3O4S and a molecular weight of 381.50 g/mol. Its IUPAC name is ethyl 4-[4-(benzenesulfonyl)piperazin-1-yl]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[4-(benzenesulfonyl)piperazin-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 1151828 |
| Molecular Formula | C18H27N3O4S |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | ethyl 4-[4-(benzenesulfonyl)piperazin-1-yl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N2CCN(S(=O)(=O)c3ccccc3)CC2)CC1 |
| InChI | InChI=1S/C18H27N3O4S/c1-2-25-18(22)20-10-8-16(9-11-20)19-12-14-21(15-13-19)26(23,24)17-6-4-3-5-7-17/h3-7,16H,2,8-15H2,1H3 |
| InChIKey | QOQNPUBQRWWMCW-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |