C15H23N7O4S — CID 168604390
ethyl 4-[4-[[amino-(diaminomethylideneamino)methylidene]amino]phenyl]sulfonylpiperazine-1-carboxylate (PubChem CID 168604390) has the molecular formula C15H23N7O4S and a molecular weight of 397.46 g/mol. Its IUPAC name is ethyl 4-[4-[[amino-(diaminomethylideneamino)methylidene]amino]phenyl]sulfonylpiperazine-1-carboxylate.
| Compound Name | ethyl 4-[4-[[amino-(diaminomethylideneamino)methylidene]amino]phenyl]sulfonylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 168604390 |
| Molecular Formula | C15H23N7O4S |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | ethyl 4-[4-[[amino-(diaminomethylideneamino)methylidene]amino]phenyl]sulfonylpiperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(S(=O)(=O)c2ccc(/N=C(\N)N=C(N)N)cc2)CC1 |
| InChI | InChI=1S/C15H23N7O4S/c1-2-26-15(23)21-7-9-22(10-8-21)27(24,25)12-5-3-11(4-6-12)19-14(18)20-13(16)17/h3-6H,2,7-10H2,1H3,(H6,16,17,18,19,20) |
| InChIKey | WEIPUWFSXBETLY-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 169.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|