C16H23N7O3 — CID 168603515
ethyl 4-[2-[[amino-(diaminomethylideneamino)methylidene]amino]benzoyl]piperazine-1-carboxylate (PubChem CID 168603515) has the molecular formula C16H23N7O3 and a molecular weight of 361.41 g/mol. Its IUPAC name is ethyl 4-[2-[[amino-(diaminomethylideneamino)methylidene]amino]benzoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-[[amino-(diaminomethylideneamino)methylidene]amino]benzoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 168603515 |
| Molecular Formula | C16H23N7O3 |
| Molecular Weight | 361.41 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | ethyl 4-[2-[[amino-(diaminomethylideneamino)methylidene]amino]benzoyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)c2ccccc2/N=C(/N)N=C(N)N)CC1 |
| InChI | InChI=1S/C16H23N7O3/c1-2-26-16(25)23-9-7-22(8-10-23)13(24)11-5-3-4-6-12(11)20-15(19)21-14(17)18/h3-6H,2,7-10H2,1H3,(H6,17,18,19,20,21) |
| InChIKey | ZNMGVCTXMHSBKL-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 152.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.41 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|