C17H22ClN3O3 — CID 169367907
ethyl 1-[2-[(1-amino-2-chloroethylidene)amino]benzoyl]piperidine-4-carboxylate (PubChem CID 169367907) has the molecular formula C17H22ClN3O3 and a molecular weight of 351.83 g/mol. Its IUPAC name is ethyl 1-[2-[(1-amino-2-chloroethylidene)amino]benzoyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[2-[(1-amino-2-chloroethylidene)amino]benzoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 169367907 |
| Molecular Formula | C17H22ClN3O3 |
| Molecular Weight | 351.83 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | ethyl 1-[2-[(1-amino-2-chloroethylidene)amino]benzoyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)c2ccccc2/N=C(\N)CCl)CC1 |
| InChI | InChI=1S/C17H22ClN3O3/c1-2-24-17(23)12-7-9-21(10-8-12)16(22)13-5-3-4-6-14(13)20-15(19)11-18/h3-6,12H,2,7-11H2,1H3,(H2,19,20) |
| InChIKey | ADEVMZZWGMEPMH-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.83 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|